C23H33N5O10 — CID 18747458
5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18747458) has the molecular formula C23H33N5O10 and a molecular weight of 539.54 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18747458 |
| Molecular Formula | C23H33N5O10 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H33N5O10/c1-11(29)19(25)22(36)26-14(7-9-18(32)33)20(34)28-16(10-12-2-4-13(30)5-3-12)21(35)27-15(23(37)38)6-8-17(24)31/h2-5,11,14-16,19,29-30H,6-10,25H2,1H3,(H2,24,31)(H,26,36)(H,27,35)(H,28,34)(H,32,33)(H,37,38) |
| InChIKey | CKHFEYNOEYVLTQ-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |