C22H30N4O11 — CID 18746411
4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 18746411) has the molecular formula C22H30N4O11 and a molecular weight of 526.50 g/mol. Its IUPAC name is 4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18746411 |
| Molecular Formula | C22H30N4O11 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-5-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H30N4O11/c1-10(27)18(23)21(35)25-14(9-17(31)32)20(34)24-13(6-7-16(29)30)19(33)26-15(22(36)37)8-11-2-4-12(28)5-3-11/h2-5,10,13-15,18,27-28H,6-9,23H2,1H3,(H,24,34)(H,25,35)(H,26,33)(H,29,30)(H,31,32)(H,36,37) |
| InChIKey | YCGAUABYHALCRD-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 265.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |