C22H31N5O10 — CID 19941379
2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid (PubChem CID 19941379) has the molecular formula C22H31N5O10 and a molecular weight of 525.52 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19941379 |
| Molecular Formula | C22H31N5O10 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H31N5O10/c1-10(28)18(24)21(35)26-14(8-11-2-4-12(29)5-3-11)20(34)25-13(6-7-16(23)30)19(33)27-15(22(36)37)9-17(31)32/h2-5,10,13-15,18,28-29H,6-9,24H2,1H3,(H2,23,30)(H,25,34)(H,26,35)(H,27,33)(H,31,32)(H,36,37) |
| InChIKey | XZLFSOWCXVYXQW-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |