C23H36N6O8 — CID 18749849
4-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 18749849) has the molecular formula C23H36N6O8 and a molecular weight of 524.58 g/mol. Its IUPAC name is 4-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18749849 |
| Molecular Formula | C23H36N6O8 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 4-amino-2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C23H36N6O8/c1-12(30)19(26)22(35)27-15(4-2-3-9-24)20(33)28-16(10-13-5-7-14(31)8-6-13)21(34)29-17(23(36)37)11-18(25)32/h5-8,12,15-17,19,30-31H,2-4,9-11,24,26H2,1H3,(H2,25,32)(H,27,35)(H,28,33)(H,29,34)(H,36,37) |
| InChIKey | FIDUIXFUHYCYQJ-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|