C21H33N5O7 — CID 19941483
2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 19941483) has the molecular formula C21H33N5O7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 19941483 |
| Molecular Formula | C21H33N5O7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H33N5O7/c1-12(27)18(23)21(33)26-16(10-13-5-7-14(28)8-6-13)20(32)25-15(4-2-3-9-22)19(31)24-11-17(29)30/h5-8,12,15-16,18,27-28H,2-4,9-11,22-23H2,1H3,(H,24,31)(H,25,32)(H,26,33)(H,29,30) |
| InChIKey | NKAKBGYVLQULPN-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|