C21H32N6O7 — CID 22656833
2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid (PubChem CID 22656833) has the molecular formula C21H32N6O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22656833 |
| Molecular Formula | C21H32N6O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(N)CC(N)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H32N6O7/c22-8-2-1-3-15(26-19(32)14(23)10-17(24)29)21(34)27-16(20(33)25-11-18(30)31)9-12-4-6-13(28)7-5-12/h4-7,14-16,28H,1-3,8-11,22-23H2,(H2,24,29)(H,25,33)(H,26,32)(H,27,34)(H,30,31) |
| InChIKey | WJWVCSPRZDGVBL-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|