C20H31N5O6S — CID 18304265
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid (PubChem CID 18304265) has the molecular formula C20H31N5O6S and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18304265 |
| Molecular Formula | C20H31N5O6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid |
| SMILES | NCCCCC(N)C(=O)NC(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H31N5O6S/c21-8-2-1-3-14(22)18(29)25-16(11-32)20(31)24-15(19(30)23-10-17(27)28)9-12-4-6-13(26)7-5-12/h4-7,14-16,26,32H,1-3,8-11,21-22H2,(H,23,30)(H,24,31)(H,25,29)(H,27,28) |
| InChIKey | VBJCGADCUYWDDH-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|