C25H40N6O8 — CID 18307014
2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid (PubChem CID 18307014) has the molecular formula C25H40N6O8 and a molecular weight of 552.63 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18307014 |
| Molecular Formula | C25H40N6O8 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H40N6O8/c26-11-3-1-5-17(28)22(35)29-18(6-2-4-12-27)23(36)30-19(13-15-7-9-16(32)10-8-15)24(37)31-20(25(38)39)14-21(33)34/h7-10,17-20,32H,1-6,11-14,26-28H2,(H,29,35)(H,30,36)(H,31,37)(H,33,34)(H,38,39) |
| InChIKey | PKSOFUIKBDTATC-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|