C24H36N6O9 — CID 18309565
2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid (PubChem CID 18309565) has the molecular formula C24H36N6O9 and a molecular weight of 552.59 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18309565 |
| Molecular Formula | C24H36N6O9 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H36N6O9/c25-10-2-1-3-15(26)21(35)29-17(11-13-4-6-14(31)7-5-13)23(37)28-16(8-9-19(27)32)22(36)30-18(24(38)39)12-20(33)34/h4-7,15-18,31H,1-3,8-12,25-26H2,(H2,27,32)(H,28,37)(H,29,35)(H,30,36)(H,33,34)(H,38,39) |
| InChIKey | GAGPSOBKAWOJHX-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 277.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|