C23H36N6O7 — CID 18302463
2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18302463) has the molecular formula C23H36N6O7 and a molecular weight of 508.58 g/mol. Its IUPAC name is 2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18302463 |
| Molecular Formula | C23H36N6O7 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H36N6O7/c1-13(27-21(33)16(25)4-2-3-11-24)20(32)28-17(9-10-19(26)31)22(34)29-18(23(35)36)12-14-5-7-15(30)8-6-14/h5-8,13,16-18,30H,2-4,9-12,24-25H2,1H3,(H2,26,31)(H,27,33)(H,28,32)(H,29,34)(H,35,36) |
| InChIKey | RDOKMHOAYJDISS-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|