C27H37N5O6S — CID 18309535
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18309535) has the molecular formula C27H37N5O6S and a molecular weight of 559.69 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18309535 |
| Molecular Formula | C27H37N5O6S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H37N5O6S/c28-13-5-4-8-20(29)24(34)30-21(14-18-9-11-19(33)12-10-18)25(35)32-23(16-39)26(36)31-22(27(37)38)15-17-6-2-1-3-7-17/h1-3,6-7,9-12,20-23,33,39H,4-5,8,13-16,28-29H2,(H,30,34)(H,31,36)(H,32,35)(H,37,38) |
| InChIKey | QKFOMJYNUWNWKI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|