C27H37N5O7S — CID 19954472
2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 19954472) has the molecular formula C27H37N5O7S and a molecular weight of 575.69 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19954472 |
| Molecular Formula | C27H37N5O7S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C27H37N5O7S/c28-12-2-1-3-21(30-24(35)20(29)13-16-4-8-18(33)9-5-16)25(36)32-23(15-40)26(37)31-22(27(38)39)14-17-6-10-19(34)11-7-17/h4-11,20-23,33-34,40H,1-3,12-15,28-29H2,(H,30,35)(H,31,37)(H,32,36)(H,38,39) |
| InChIKey | KTBNFFMULBYXSX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|