C22H33N5O8S — CID 18258952
3-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 18258952) has the molecular formula C22H33N5O8S and a molecular weight of 527.60 g/mol. Its IUPAC name is 3-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18258952 |
| Molecular Formula | C22H33N5O8S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 3-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CS)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H33N5O8S/c23-8-2-1-3-15(25-19(31)14(24)11-36)20(32)26-16(10-18(29)30)21(33)27-17(22(34)35)9-12-4-6-13(28)7-5-12/h4-7,14-17,28,36H,1-3,8-11,23-24H2,(H,25,31)(H,26,32)(H,27,33)(H,29,30)(H,34,35) |
| InChIKey | VQIYYWPDYRELEM-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|