C24H40N6O6S — CID 18259112
2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18259112) has the molecular formula C24H40N6O6S and a molecular weight of 540.69 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18259112 |
| Molecular Formula | C24H40N6O6S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H40N6O6S/c25-11-3-1-5-18(28-21(32)17(27)14-37)22(33)29-19(6-2-4-12-26)23(34)30-20(24(35)36)13-15-7-9-16(31)10-8-15/h7-10,17-20,31,37H,1-6,11-14,25-27H2,(H,28,32)(H,29,33)(H,30,34)(H,35,36) |
| InChIKey | KVAYFZWSKIUAFP-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|