C18H28N4O5S — CID 10136408
(2R)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 10136408) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 10136408 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C18H28N4O5S/c19-8-2-1-3-13(20)16(24)21-14(9-11-4-6-12(23)7-5-11)17(25)22-15(10-28)18(26)27/h4-7,13-15,23,28H,1-3,8-10,19-20H2,(H,21,24)(H,22,25)(H,26,27)/t13-,14-,15-/m0/s1 |
| InChIKey | HONVOXINDBETTI-KKUMJFAQSA-N |
| XLogP | -0.62 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|