C22H34N6O7S — CID 18309524
4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid (PubChem CID 18309524) has the molecular formula C22H34N6O7S and a molecular weight of 526.62 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18309524 |
| Molecular Formula | C22H34N6O7S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 4-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H34N6O7S/c23-8-2-1-3-14(24)19(31)26-15(9-12-4-6-13(29)7-5-12)20(32)28-17(11-36)21(33)27-16(22(34)35)10-18(25)30/h4-7,14-17,29,36H,1-3,8-11,23-24H2,(H2,25,30)(H,26,31)(H,27,33)(H,28,32)(H,34,35) |
| InChIKey | GZIRKZKZKHACRK-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|