C23H37N5O6S2 — CID 19998283
2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19998283) has the molecular formula C23H37N5O6S2 and a molecular weight of 543.71 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19998283 |
| Molecular Formula | C23H37N5O6S2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C23H37N5O6S2/c1-36-11-9-16(25)20(30)26-17(4-2-3-10-24)21(31)27-18(12-14-5-7-15(29)8-6-14)22(32)28-19(13-35)23(33)34/h5-8,16-19,29,35H,2-4,9-13,24-25H2,1H3,(H,26,30)(H,27,31)(H,28,32)(H,33,34) |
| InChIKey | RNAFVXBELRCXQA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|