C33H41N5O6 — CID 175978813
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 175978813) has the molecular formula C33H41N5O6 and a molecular weight of 603.72 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175978813 |
| Molecular Formula | C33H41N5O6 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H41N5O6/c34-18-8-7-13-27(33(43)44)36-31(41)29(21-24-14-16-25(39)17-15-24)38-32(42)28(20-23-11-5-2-6-12-23)37-30(40)26(35)19-22-9-3-1-4-10-22/h1-6,9-12,14-17,26-29,39H,7-8,13,18-21,34-35H2,(H,36,41)(H,37,40)(H,38,42)(H,43,44)/t26-,27-,28-,29-/m0/s1 |
| InChIKey | DALLGFHVABKGAE-DZUOILHNSA-N |
| XLogP | 1.42 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|