C27H37N5O6 — CID 10279918
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]hexanoic acid (PubChem CID 10279918) has the molecular formula C27H37N5O6 and a molecular weight of 527.62 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10279918 |
| Molecular Formula | C27H37N5O6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]hexanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C27H37N5O6/c1-17(24(34)31-22(27(37)38)9-5-6-14-28)30-26(36)23(16-18-7-3-2-4-8-18)32-25(35)21(29)15-19-10-12-20(33)13-11-19/h2-4,7-8,10-13,17,21-23,33H,5-6,9,14-16,28-29H2,1H3,(H,30,36)(H,31,34)(H,32,35)(H,37,38)/t17-,21-,22-,23-/m0/s1 |
| InChIKey | KVFJCGQARZQJSS-ZMVGRULKSA-N |
| XLogP | 0.19 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|