C24H40N6O6 — CID 19950246
6-amino-2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]hexanoic acid (PubChem CID 19950246) has the molecular formula C24H40N6O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is 6-amino-2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19950246 |
| Molecular Formula | C24H40N6O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 6-amino-2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]hexanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C24H40N6O6/c1-15(28-22(33)18(27)14-16-8-10-17(31)11-9-16)21(32)29-19(6-2-4-12-25)23(34)30-20(24(35)36)7-3-5-13-26/h8-11,15,18-20,31H,2-7,12-14,25-27H2,1H3,(H,28,33)(H,29,32)(H,30,34)(H,35,36) |
| InChIKey | PZFSIYLDHKLPHN-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|