C22H35N5O7 — CID 19950251
2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 19950251) has the molecular formula C22H35N5O7 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19950251 |
| Molecular Formula | C22H35N5O7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C22H35N5O7/c1-12(25-20(31)16(24)11-14-6-8-15(29)9-7-14)19(30)26-17(5-3-4-10-23)21(32)27-18(13(2)28)22(33)34/h6-9,12-13,16-18,28-29H,3-5,10-11,23-24H2,1-2H3,(H,25,31)(H,26,30)(H,27,32)(H,33,34) |
| InChIKey | LGJUQUUMCCFVTG-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|