C23H37N5O6 — CID 19950254
2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-methylbutanoic acid (PubChem CID 19950254) has the molecular formula C23H37N5O6 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19950254 |
| Molecular Formula | C23H37N5O6 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 2-[[6-amino-2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C23H37N5O6/c1-13(2)19(23(33)34)28-22(32)18(6-4-5-11-24)27-20(30)14(3)26-21(31)17(25)12-15-7-9-16(29)10-8-15/h7-10,13-14,17-19,29H,4-6,11-12,24-25H2,1-3H3,(H,26,31)(H,27,30)(H,28,32)(H,33,34) |
| InChIKey | YUQSCHRDJMAAQM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|