C22H33N5O8 — CID 19954435
3-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-(1-carboxyethylamino)-4-oxobutanoic acid (PubChem CID 19954435) has the molecular formula C22H33N5O8 and a molecular weight of 495.53 g/mol. Its IUPAC name is 3-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-(1-carboxyethylamino)-4-oxobutanoic acid.
| Compound Name | 3-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-(1-carboxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19954435 |
| Molecular Formula | C22H33N5O8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 3-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-(1-carboxyethylamino)-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(CC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H33N5O8/c1-12(22(34)35)25-21(33)17(11-18(29)30)27-20(32)16(4-2-3-9-23)26-19(31)15(24)10-13-5-7-14(28)8-6-13/h5-8,12,15-17,28H,2-4,9-11,23-24H2,1H3,(H,25,33)(H,26,31)(H,27,32)(H,29,30)(H,34,35) |
| InChIKey | HBWXXPZZNCWTNG-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|