C20H31N5O6 — CID 19953008
2-[[6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 19953008) has the molecular formula C20H31N5O6 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19953008 |
| Molecular Formula | C20H31N5O6 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H31N5O6/c1-12(20(30)31)24-19(29)16(4-2-3-9-21)25-17(27)11-23-18(28)15(22)10-13-5-7-14(26)8-6-13/h5-8,12,15-16,26H,2-4,9-11,21-22H2,1H3,(H,23,28)(H,24,29)(H,25,27)(H,30,31) |
| InChIKey | BADCSXGLMQKWTP-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|