C20H31N5O7 — CID 18309749
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid (PubChem CID 18309749) has the molecular formula C20H31N5O7 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18309749 |
| Molecular Formula | C20H31N5O7 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H31N5O7/c21-8-2-1-3-14(22)18(30)24-15(9-12-4-6-13(27)7-5-12)20(32)25-16(11-26)19(31)23-10-17(28)29/h4-7,14-16,26-27H,1-3,8-11,21-22H2,(H,23,31)(H,24,30)(H,25,32)(H,28,29) |
| InChIKey | ZZPXSLNIZTUYSI-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|