C25H40N6O7 — CID 18296161
4-amino-2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 18296161) has the molecular formula C25H40N6O7 and a molecular weight of 536.63 g/mol. Its IUPAC name is 4-amino-2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18296161 |
| Molecular Formula | C25H40N6O7 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 4-amino-2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H40N6O7/c1-3-14(2)21(28)24(36)29-17(6-4-5-11-26)22(34)30-18(12-15-7-9-16(32)10-8-15)23(35)31-19(25(37)38)13-20(27)33/h7-10,14,17-19,21,32H,3-6,11-13,26,28H2,1-2H3,(H2,27,33)(H,29,36)(H,30,34)(H,31,35)(H,37,38) |
| InChIKey | IKNIDLOOXYYAOE-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|