C22H35N7O6 — CID 138602979
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]butanediamide (PubChem CID 138602979) has the molecular formula C22H35N7O6 and a molecular weight of 493.57 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]butanediamide.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]butanediamide |
|---|---|
| PubChem CID | 138602979 |
| Molecular Formula | C22H35N7O6 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]butanediamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CC(N)=O)C(N)=O |
| InChI | InChI=1S/C22H35N7O6/c23-9-5-4-8-15(21(34)28-16(19(26)32)11-18(25)31)27-22(35)17(29-20(33)14(24)12-30)10-13-6-2-1-3-7-13/h1-3,6-7,14-17,30H,4-5,8-12,23-24H2,(H2,25,31)(H2,26,32)(H,27,35)(H,28,34)(H,29,33)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | CLIFGNDARKNMJD-QAETUUGQSA-N |
| XLogP | -3.51 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|