C25H42N6O6 — CID 18308915
6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 18308915) has the molecular formula C25H42N6O6 and a molecular weight of 522.65 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18308915 |
| Molecular Formula | C25H42N6O6 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCCN)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C25H42N6O6/c1-16(32)21(31-22(33)18(28)11-5-7-13-26)24(35)30-20(15-17-9-3-2-4-10-17)23(34)29-19(25(36)37)12-6-8-14-27/h2-4,9-10,16,18-21,32H,5-8,11-15,26-28H2,1H3,(H,29,34)(H,30,35)(H,31,33)(H,36,37) |
| InChIKey | WEABZSCKDGQVRM-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|