C28H39N5O6 — CID 18307725
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18307725) has the molecular formula C28H39N5O6 and a molecular weight of 541.65 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18307725 |
| Molecular Formula | C28H39N5O6 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C28H39N5O6/c1-18(34)24(28(38)39)33-27(37)23(17-20-12-6-3-7-13-20)32-26(36)22(16-19-10-4-2-5-11-19)31-25(35)21(30)14-8-9-15-29/h2-7,10-13,18,21-24,34H,8-9,14-17,29-30H2,1H3,(H,31,35)(H,32,36)(H,33,37)(H,38,39) |
| InChIKey | DFYKPBBKIUODEH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|