C18H28N4O4 — CID 18222554
2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 18222554) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18222554 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C18H28N4O4/c1-12(18(25)26)21-17(24)15(11-13-7-3-2-4-8-13)22-16(23)14(20)9-5-6-10-19/h2-4,7-8,12,14-15H,5-6,9-11,19-20H2,1H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | ALEVUGKHINJNIF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|