C29H38N6O5 — CID 18309303
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 18309303) has the molecular formula C29H38N6O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18309303 |
| Molecular Formula | C29H38N6O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C29H38N6O5/c1-18(29(39)40)33-27(37)24(15-19-9-3-2-4-10-19)35-28(38)25(34-26(36)22(31)12-7-8-14-30)16-20-17-32-23-13-6-5-11-21(20)23/h2-6,9-11,13,17-18,22,24-25,32H,7-8,12,14-16,30-31H2,1H3,(H,33,37)(H,34,36)(H,35,38)(H,39,40) |
| InChIKey | IZJLRLYRHNOBHJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|