C32H44N6O5 — CID 18307799
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 18307799) has the molecular formula C32H44N6O5 and a molecular weight of 592.74 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18307799 |
| Molecular Formula | C32H44N6O5 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C32H44N6O5/c1-20(2)16-28(32(42)43)38-31(41)27(18-22-19-35-25-14-7-6-12-23(22)25)37-30(40)26(17-21-10-4-3-5-11-21)36-29(39)24(34)13-8-9-15-33/h3-7,10-12,14,19-20,24,26-28,35H,8-9,13,15-18,33-34H2,1-2H3,(H,36,39)(H,37,40)(H,38,41)(H,42,43) |
| InChIKey | RUAKPSYVQVCDEF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|