C28H44N6O5 — CID 18309432
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid (PubChem CID 18309432) has the molecular formula C28H44N6O5 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18309432 |
| Molecular Formula | C28H44N6O5 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCCN)C(C)C)C(=O)O |
| InChI | InChI=1S/C28H44N6O5/c1-16(2)13-23(28(38)39)33-27(37)24(17(3)4)34-26(36)22(32-25(35)20(30)10-7-8-12-29)14-18-15-31-21-11-6-5-9-19(18)21/h5-6,9,11,15-17,20,22-24,31H,7-8,10,12-14,29-30H2,1-4H3,(H,32,35)(H,33,37)(H,34,36)(H,38,39) |
| InChIKey | IOLLDURBVMUNLA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 192.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|