C27H42N6O6 — CID 18306620
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18306620) has the molecular formula C27H42N6O6 and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18306620 |
| Molecular Formula | C27H42N6O6 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C27H42N6O6/c1-15(2)12-21(31-24(35)19(29)9-6-7-11-28)25(36)32-22(26(37)33-23(16(3)34)27(38)39)13-17-14-30-20-10-5-4-8-18(17)20/h4-5,8,10,14-16,19,21-23,30,34H,6-7,9,11-13,28-29H2,1-3H3,(H,31,35)(H,32,36)(H,33,37)(H,38,39) |
| InChIKey | SPMJHUZOPGJVHX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 212.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|