C27H43N9O6 — CID 22651122
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 22651122) has the molecular formula C27H43N9O6 and a molecular weight of 589.70 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22651122 |
| Molecular Formula | C27H43N9O6 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCCCN)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H43N9O6/c1-15(37)22(26(41)42)36-24(39)20(10-4-5-11-28)34-25(40)21(13-16-14-33-19-9-3-2-7-17(16)19)35-23(38)18(29)8-6-12-32-27(30)31/h2-3,7,9,14-15,18,20-22,33,37H,4-6,8,10-13,28-29H2,1H3,(H,34,40)(H,35,38)(H,36,39)(H,41,42)(H4,30,31,32) |
| InChIKey | XHLOWGRANGGAOY-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 277.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|