C23H36N8O4 — CID 10184805
(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 10184805) has the molecular formula C23H36N8O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 10184805 |
| Molecular Formula | C23H36N8O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H36N8O4/c24-10-4-3-7-16(25)20(32)30-18(9-5-11-28-23(26)27)21(33)31-19(22(34)35)12-14-13-29-17-8-2-1-6-15(14)17/h1-2,6,8,13,16,18-19,29H,3-5,7,9-12,24-25H2,(H,30,32)(H,31,33)(H,34,35)(H4,26,27,28)/t16-,18-,19-/m0/s1 |
| InChIKey | NLOZZWJNIKKYSC-WDSOQIARSA-N |
| XLogP | -0.73 |
| TPSA | 227.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|