C23H36N10O4 — CID 10164777
(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 10164777) has the molecular formula C23H36N10O4 and a molecular weight of 516.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 10164777 |
| Molecular Formula | C23H36N10O4 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H36N10O4/c24-15(6-3-9-29-22(25)26)19(34)32-17(8-4-10-30-23(27)28)20(35)33-18(21(36)37)11-13-12-31-16-7-2-1-5-14(13)16/h1-2,5,7,12,15,17-18,31H,3-4,6,8-11,24H2,(H,32,34)(H,33,35)(H,36,37)(H4,25,26,29)(H4,27,28,30)/t15-,17-,18-/m0/s1 |
| InChIKey | JTKLCCFLSLCCST-SZMVWBNQSA-N |
| XLogP | -1.80 |
| TPSA | 266.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|