C18H26N6O3 — CID 175889244
(2S)-2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 175889244) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 175889244 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-6-(diaminomethylideneamino)hexanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(N)=NCCCC[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H26N6O3/c19-13(6-3-4-8-22-18(20)21)16(25)24-15(17(26)27)9-11-10-23-14-7-2-1-5-12(11)14/h1-2,5,7,10,13,15,23H,3-4,6,8-9,19H2,(H,24,25)(H,26,27)(H4,20,21,22)/t13-,15-/m0/s1 |
| InChIKey | ZCQIGHHQSFCUME-ZFWWWQNUSA-N |
| XLogP | 0.05 |
| TPSA | 172.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|