C20H30N8O4 — CID 175812025
(2S)-3-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid (PubChem CID 175812025) has the molecular formula C20H30N8O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S)-3-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175812025 |
| Molecular Formula | C20H30N8O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2S)-3-amino-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid |
| SMILES | NC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H30N8O4/c21-9-16(19(31)32)28-18(30)15(8-11-10-26-14-6-2-1-4-12(11)14)27-17(29)13(22)5-3-7-25-20(23)24/h1-2,4,6,10,13,15-16,26H,3,5,7-9,21-22H2,(H,27,29)(H,28,30)(H,31,32)(H4,23,24,25)/t13-,15-,16-/m0/s1 |
| InChIKey | ZJWQRNUMUPPBFK-BPUTZDHNSA-N |
| XLogP | -1.90 |
| TPSA | 227.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|