C23H35N7O4 — CID 25069730
(2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 25069730) has the molecular formula C23H35N7O4 and a molecular weight of 473.58 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 25069730 |
| Molecular Formula | C23H35N7O4 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H35N7O4/c1-13(2)10-19(22(33)34)30-21(32)18(11-14-12-28-17-8-4-3-6-15(14)17)29-20(31)16(24)7-5-9-27-23(25)26/h3-4,6,8,12-13,16,18-19,28H,5,7,9-11,24H2,1-2H3,(H,29,31)(H,30,32)(H,33,34)(H4,25,26,27)/t16-,18-,19-/m0/s1 |
| InChIKey | YHZQOSXDTFRZKU-WDSOQIARSA-N |
| XLogP | 0.19 |
| TPSA | 201.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|