C26H40N8O5 — CID 18244509
2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18244509) has the molecular formula C26H40N8O5 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18244509 |
| Molecular Formula | C26H40N8O5 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 2-[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H40N8O5/c1-14(2)11-20(33-23(36)18(27)8-6-10-30-26(28)29)24(37)32-15(3)22(35)34-21(25(38)39)12-16-13-31-19-9-5-4-7-17(16)19/h4-5,7,9,13-15,18,20-21,31H,6,8,10-12,27H2,1-3H3,(H,32,37)(H,33,36)(H,34,35)(H,38,39)(H4,28,29,30) |
| InChIKey | ICHFQNMKVAPVFO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|