C26H40N8O6 — CID 22650307
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22650307) has the molecular formula C26H40N8O6 and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22650307 |
| Molecular Formula | C26H40N8O6 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H40N8O6/c1-14(2)10-19(32-24(38)21(13-35)34-22(36)17(27)7-5-9-30-26(28)29)23(37)33-20(25(39)40)11-15-12-31-18-8-4-3-6-16(15)18/h3-4,6,8,12,14,17,19-21,31,35H,5,7,9-11,13,27H2,1-2H3,(H,32,38)(H,33,37)(H,34,36)(H,39,40)(H4,28,29,30) |
| InChIKey | FDVKUJOBSMECIH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 251.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|