C26H41N9O6 — CID 18303022
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18303022) has the molecular formula C26H41N9O6 and a molecular weight of 575.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18303022 |
| Molecular Formula | C26H41N9O6 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H41N9O6/c27-10-4-3-7-17(28)22(37)33-19(9-5-11-31-26(29)30)23(38)35-21(14-36)24(39)34-20(25(40)41)12-15-13-32-18-8-2-1-6-16(15)18/h1-2,6,8,13,17,19-21,32,36H,3-5,7,9-12,14,27-28H2,(H,33,37)(H,34,39)(H,35,38)(H,40,41)(H4,29,30,31) |
| InChIKey | ILMUYWGJWYOOCY-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 277.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|