C23H37N9O3 — CID 175995773
(2S)-2,6-diamino-N-[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]hexanamide (PubChem CID 175995773) has the molecular formula C23H37N9O3 and a molecular weight of 487.61 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 175995773 |
| Molecular Formula | C23H37N9O3 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C23H37N9O3/c24-10-4-3-7-16(25)21(34)31-18(9-5-11-29-23(27)28)22(35)32-19(20(26)33)12-14-13-30-17-8-2-1-6-15(14)17/h1-2,6,8,13,16,18-19,30H,3-5,7,9-12,24-25H2,(H2,26,33)(H,31,34)(H,32,35)(H4,27,28,29)/t16-,18-,19-/m0/s1 |
| InChIKey | VAKZPVSJWROHLY-WDSOQIARSA-N |
| XLogP | -1.32 |
| TPSA | 233.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|