C29H48N12O5 — CID 18302753
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18302753) has the molecular formula C29H48N12O5 and a molecular weight of 644.78 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18302753 |
| Molecular Formula | C29H48N12O5 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H48N12O5/c30-12-4-3-8-19(31)24(42)39-21(10-5-13-36-28(32)33)25(43)40-22(11-6-14-37-29(34)35)26(44)41-23(27(45)46)15-17-16-38-20-9-2-1-7-18(17)20/h1-2,7,9,16,19,21-23,38H,3-6,8,10-15,30-31H2,(H,39,42)(H,40,43)(H,41,44)(H,45,46)(H4,32,33,36)(H4,34,35,37) |
| InChIKey | AAJLAGUZZKJMKR-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 321.23 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|