C29H48N10O5 — CID 19946465
6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 19946465) has the molecular formula C29H48N10O5 and a molecular weight of 616.77 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19946465 |
| Molecular Formula | C29H48N10O5 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H48N10O5/c30-13-5-3-10-22(37-25(40)20(32)16-18-17-36-21-9-2-1-8-19(18)21)26(41)38-23(12-7-15-35-29(33)34)27(42)39-24(28(43)44)11-4-6-14-31/h1-2,8-9,17,20,22-24,36H,3-7,10-16,30-32H2,(H,37,40)(H,38,41)(H,39,42)(H,43,44)(H4,33,34,35) |
| InChIKey | JLEXDYIXUUKVCK-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 282.85 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|