C27H41N9O7 — CID 18251232
2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18251232) has the molecular formula C27H41N9O7 and a molecular weight of 603.68 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18251232 |
| Molecular Formula | C27H41N9O7 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-carboxypropanoyl)amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H41N9O7/c28-10-4-3-8-19(34-23(39)17(29)13-22(37)38)24(40)36-21(12-15-14-33-18-7-2-1-6-16(15)18)25(41)35-20(26(42)43)9-5-11-32-27(30)31/h1-2,6-7,14,17,19-21,33H,3-5,8-13,28-29H2,(H,34,39)(H,35,41)(H,36,40)(H,37,38)(H,42,43)(H4,30,31,32) |
| InChIKey | XQHDPTRFZBSQNU-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|