C26H41N9O5S — CID 18258911
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18258911) has the molecular formula C26H41N9O5S and a molecular weight of 591.74 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18258911 |
| Molecular Formula | C26H41N9O5S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CS)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H41N9O5S/c27-10-4-3-8-19(33-22(36)17(28)14-41)23(37)34-20(9-5-11-31-26(29)30)24(38)35-21(25(39)40)12-15-13-32-18-7-2-1-6-16(15)18/h1-2,6-7,13,17,19-21,32,41H,3-5,8-12,14,27-28H2,(H,33,36)(H,34,37)(H,35,38)(H,39,40)(H4,29,30,31) |
| InChIKey | SSIUNBOXXFSEPE-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 256.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|