C29H38N8O5S — CID 18259710
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18259710) has the molecular formula C29H38N8O5S and a molecular weight of 610.74 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18259710 |
| Molecular Formula | C29H38N8O5S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H38N8O5S/c30-20(16-43)25(38)36-23(13-17-7-2-1-3-8-17)27(40)35-22(11-6-12-33-29(31)32)26(39)37-24(28(41)42)14-18-15-34-21-10-5-4-9-19(18)21/h1-5,7-10,15,20,22-24,34,43H,6,11-14,16,30H2,(H,35,40)(H,36,38)(H,37,39)(H,41,42)(H4,31,32,33) |
| InChIKey | PSLRVEMTXJGYTA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|