C30H39N9O6 — CID 22657302
2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22657302) has the molecular formula C30H39N9O6 and a molecular weight of 621.70 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22657302 |
| Molecular Formula | C30H39N9O6 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C30H39N9O6/c31-20(15-25(32)40)26(41)38-23(13-17-7-2-1-3-8-17)28(43)37-22(11-6-12-35-30(33)34)27(42)39-24(29(44)45)14-18-16-36-21-10-5-4-9-19(18)21/h1-5,7-10,16,20,22-24,36H,6,11-15,31H2,(H2,32,40)(H,37,43)(H,38,41)(H,39,42)(H,44,45)(H4,33,34,35) |
| InChIKey | WVUQVEZMIIOQDQ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 273.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|